N-[(2'-Cyano[1,1'-biphenyl]-4-yl)methyl]-L-valine methyl ester hydrochloride structure
|
Common Name | N-[(2'-Cyano[1,1'-biphenyl]-4-yl)methyl]-L-valine methyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 482577-59-3 | Molecular Weight | 358.862 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23ClN2O2 | Melting Point | 186ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-[(2'-Cyano[1,1'-biphenyl]-4-yl)methyl]-L-valine methyl ester hydrochloride(S)-Methyl 2-(((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)amino)-3-methylbutanoate hydrochloride is a valine derivative[1]. |
| Name | N-(2'-Cyanobiphenyl-4-ylmethyl)-L-valine Methyl Ester Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Methyl 2-(((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)amino)-3-methylbutanoate hydrochloride is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Melting Point | 186ºC |
|---|---|
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.862 |
| Exact Mass | 358.144806 |
| PSA | 62.12000 |
| LogP | 4.70538 |
| InChIKey | AZQXUWUZQLZNIM-FYZYNONXSA-N |
| SMILES | COC(=O)C(NCc1ccc(-c2ccccc2C#N)cc1)C(C)C.Cl |
| Hazard Codes | Xi |
|---|
|
~85%
N-[(2'-Cyano[1,... CAS#:482577-59-3 |
| Literature: WO2012/56294 A1, ; Page/Page column 14 ; |
| Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (1:1) |
| N-(2'-Cyanobiphenyl-4-ylMethyl)-L-valine Methyl Ester Hydrochloride |
| L-Valine, N-[(2'-cyano[1,1'-biphenyl]-4-yl)methyl]-, methyl ester, hydrochloride (1:1) |
| methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate,hydrochloride |
| (S)-Methyl 2-(((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)amino)-3-methylbutanoate hydrochloride |
| N-[(2'-Cyano[1,1'-biphenyl]-4-yl)methyl]-L-valine methyl ester hydrochloride |
| Valsartan Impurity 17 |