Calycanthoside structure
|
Common Name | Calycanthoside | ||
|---|---|---|---|---|
| CAS Number | 483-91-0 | Molecular Weight | 384.335 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 675.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H20O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2±25.0 °C | |
Use of CalycanthosideCalycanthoside is a natural compound isolated from Angelica tenuissima[1]. |
| Name | 6,8-Dimethoxy-2-oxo-2H-chromen-7-yl β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Calycanthoside is a natural compound isolated from Angelica tenuissima[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 675.0±55.0 °C at 760 mmHg |
| Molecular Formula | C17H20O10 |
| Molecular Weight | 384.335 |
| Flash Point | 246.2±25.0 °C |
| Exact Mass | 384.105652 |
| PSA | 148.05000 |
| LogP | -1.92 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | IKUQEFGEUOOPGY-QSDFBURQSA-N |
| SMILES | COc1cc2ccc(=O)oc2c(OC)c1OC1OC(CO)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 6,8-Dimethoxy-2-oxo-2H-chromen-7-yl Beta-D-glucopyranoside |
| 6,8-Dimethoxy-2-oxo-2H-chromen-7-yl β-D-glucopyranoside |
| 2H-1-Benzopyran-2-one, 7-(β-D-glucopyranosyloxy)-6,8-dimethoxy- |