Luvangetin structure
|
Common Name | Luvangetin | ||
|---|---|---|---|---|
| CAS Number | 483-92-1 | Molecular Weight | 258.27 | |
| Density | 1.225g/cm3 | Boiling Point | 431.8ºC at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9ºC | |
Use of LuvangetinLuvangetin is a coumarin that can be isolated from Zanthoxylum avicennae[1]. |
| Name | 10-methoxy-2,2-dimethylpyrano[3,2-g]chromen-8-one |
|---|---|
| Synonym | More Synonyms |
| Description | Luvangetin is a coumarin that can be isolated from Zanthoxylum avicennae[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 431.8ºC at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 |
| Flash Point | 193.9ºC |
| Exact Mass | 258.08900 |
| PSA | 48.67000 |
| LogP | 2.98580 |
| Vapour Pressure | 1.17E-07mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | XYPWCJWXFYYGPA-UHFFFAOYSA-N |
| SMILES | COc1c2c(cc3ccc(=O)oc13)C=CC(C)(C)O2 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| Luvangetin |
| Luvangenetin |
| Demythylluvangetin-monomethylaether,Luvangetin |