tris(dimethylamino)phenylsilane structure
|
Common Name | tris(dimethylamino)phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 4840-75-9 | Molecular Weight | 237.417 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 266.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H23N3Si | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 115.2±22.6 °C | |
| Name | N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 266.9±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C12H23N3Si |
| Molecular Weight | 237.417 |
| Flash Point | 115.2±22.6 °C |
| Exact Mass | 237.166122 |
| PSA | 9.72000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | VJDVRUZAQRISHN-UHFFFAOYSA-N |
| SMILES | CN(C)[Si](c1ccccc1)(N(C)C)N(C)C |
| Risk Phrases | 10-36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 1993 |
|
~%
tris(dimethylam... CAS#:4840-75-9 |
| Literature: Washburne,S.S.; Peterson,W.R. Journal of Organometallic Chemistry, 1970 , vol. 21, p. 59 - 64 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N,N,N',N',N'',N''-Hexamethyl-1-phenylsilanetriamine |
| hexa-N-methyl-Si-phenyl-silanetriamine |
| EINECS 225-427-1 |
| Silanetriamine,N,N,N',N',N'',N''-hexamethyl-1-phenyl |