tris(dimethylamino)phenylsilane
tris(dimethylamino)phenylsilane structure
|
Common Name | tris(dimethylamino)phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 4840-75-9 | Molecular Weight | 237.417 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 266.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H23N3Si | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 115.2±22.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 266.9±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C12H23N3Si |
| Molecular Weight | 237.417 |
| Flash Point | 115.2±22.6 °C |
| Exact Mass | 237.166122 |
| PSA | 9.72000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | VJDVRUZAQRISHN-UHFFFAOYSA-N |
| SMILES | CN(C)[Si](c1ccccc1)(N(C)C)N(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | 10-36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 1993 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tris(dimethylam... CAS#:4840-75-9 |
| Literature: Washburne,S.S.; Peterson,W.R. Journal of Organometallic Chemistry, 1970 , vol. 21, p. 59 - 64 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:2097-19-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N,N',N',N'',N''-Hexamethyl-1-phenylsilanetriamine |
| hexa-N-methyl-Si-phenyl-silanetriamine |
| EINECS 225-427-1 |
| Silanetriamine,N,N,N',N',N'',N''-hexamethyl-1-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: CAS number of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is 4840-75-9. |
| Q: What is the melting point of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: Melting point of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is <0ºC. |
| Q: What is the English name of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: The English name of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine. |
| Q: What is the LogP of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: LogP of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is 2.27. |
| Q: What is the molecular weight of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: Molecular weight of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is 237.417. |
| Q: What are the upstream materials of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: Related upstream materials(CAS) of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine: 98-13-5;124-40-3. |
| Q: What English synonyms does N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine have? |
| A: English synonyms of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine: N,N,N',N',N'',N''-Hexamethyl-1-phenylsilanetriamine, hexa-N-methyl-Si-phenyl-silanetriamine, EINECS 225-427-1, Silanetriamine,N,N,N',N',N'',N''-hexamethyl-1-phenyl. |
| Q: What is the molecular formula of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: Molecular formula of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is C12H23N3Si. |
| Q: What is the polar surface area (PSA) of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: Polar surface area (PSA) of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is 9.72000. |
| Q: What is the boiling point of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine? |
| A: Boiling point of N-[bis(dimethylamino)-phenylsilyl]-N-methylmethanamine is 266.9±23.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |