2-Amino-5-(octyloxy)-5-oxopentanoic acid
Modify Date: 2025-09-23 17:14:07
2-Amino-5-(octyloxy)-5-oxopentanoic acid structure
|
Common Name | 2-Amino-5-(octyloxy)-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4852-91-9 | Molecular Weight | 259.34 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 402.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1±27.3 °C | |
Use of 2-Amino-5-(octyloxy)-5-oxopentanoic acid5-Octyl hydrogen L-glutamate is cell-permeable molecule and can be used for synthesizing 5-octyl ester derivatives (5-octyl α-ketoglutarate)[1]. |
| Name | 2-amino-5-octoxy-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Octyl hydrogen L-glutamate is cell-permeable molecule and can be used for synthesizing 5-octyl ester derivatives (5-octyl α-ketoglutarate)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.4±40.0 °C at 760 mmHg |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.34 |
| Flash Point | 197.1±27.3 °C |
| Exact Mass | 259.178345 |
| PSA | 89.62000 |
| LogP | 3.53 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | UCDDOKSXLQWTOD-NSHDSACASA-N |
| SMILES | CCCCCCCCOC(=O)CCC(N)C(=O)O |
|
~%
2-Amino-5-(octy... CAS#:4852-91-9 |
| Literature: Ren, Kaixuan; Cheng, Yilong; He, Chaoliang; Xiao, Chunsheng; Li, Gao; Chen, Xuesi Polymer (United Kingdom), 2013 , vol. 54, # 9 p. 2466 - 2472 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Amino-glutaminsaeure-octylester |
| Glutamic acid, 5-octyl ester |
| 2-Amino-5-(octyloxy)-5-oxopentanoic acid |