BDP TMR NHS ester structure
|
Common Name | BDP TMR NHS ester | ||
|---|---|---|---|---|
| CAS Number | 485397-12-4 | Molecular Weight | 495.283 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H24BF2N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP TMR NHS esterBDP TMR is a borondipyrromethene dye, analog of BODIPY? TMR. This is an amine-reactive NHS ester for the labeling of proteins, peptides, and other molecules with amino groups. |
| Name | Difluoro(1-{[3-(5-{[5-(4-methoxyphenyl)-2H-pyrrol-2-ylidene-κN]methyl}-2,4-dimethyl-1H-pyrrol-3-yl-κN)propanoyl]oxy}-2,5-pyrrolidinedionato)boron |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H24BF2N3O5 |
|---|---|
| Molecular Weight | 495.283 |
| Exact Mass | 495.177704 |
| InChIKey | XMAZILQWJQABLQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc3n2[B-](F)(F)[N+]2=C(C)C(CCC(=O)ON4C(=O)CCC4=O)=C(C)C2=C3)cc1 |
| Storage condition | -20°C |
| Difluoro(1-{[3-(5-{[5-(4-methoxyphenyl)-2H-pyrrol-2-ylidene-κN]methyl}-2,4-dimethyl-1H-pyrrol-3-yl-κN)propanoyl]oxy}-2,5-pyrrolidinedionato)boron |
| MFCD31580121 |
| Boron, difluoro[1-[3-[5-[[5-(4-methoxyphenyl)-2H-pyrrol-2-ylidene-κN]methyl]-2,4-dimethyl-1H-pyrrol-3-yl-κN]-1-oxopropoxy]-2,5-pyrrolidinedionato]- |