mersalyl acid
mersalyl acid structure
|
Common Name | mersalyl acid | ||
|---|---|---|---|---|
| CAS Number | 486-67-9 | Molecular Weight | 483.86700 | |
| Density | N/A | Boiling Point | 467.9ºC at 760mmHg | |
| Molecular Formula | C13H17HgNO6 | Melting Point | 192-193ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 236.7ºC | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | mersalyl acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 467.9ºC at 760mmHg |
|---|---|
| Melting Point | 192-193ºC (dec.)(lit.) |
| Molecular Formula | C13H17HgNO6 |
| Molecular Weight | 483.86700 |
| Flash Point | 236.7ºC |
| Exact Mass | 485.07600 |
| PSA | 105.09000 |
| LogP | 1.07400 |
| InChIKey | GCUOGPZRDRUOAP-UHFFFAOYSA-N |
| SMILES | COC(C[Hg])CNC(=O)c1ccccc1OCC(=O)O.O |
| Water Solubility | NH4OH: clear to hazy |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330-H373-H410 |
| Precautionary Statements | P260-P273-P280-P301 + P310 + P330-P302 + P352 + P310-P304 + P340 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+: Very toxic;N: Dangerous for the environment; |
| Risk Phrases | 26/27/28-33-50/53 |
| Safety Phrases | 13-28-36-45-60-61 |
| RIDADR | UN 2025 6.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
This table lists relevant public references with title, journal and publication metadata for this compound.
|
Cheminformatics analysis of assertions mined from literature that describe drug-induced liver injury in different species.
Chem. Res. Toxicol. 23 , 171-83, (2010) Drug-induced liver injury is one of the main causes of drug attrition. The ability to predict the liver effects of drug candidates from their chemical structures is critical to help guide experimental... |
|
|
Interaction of mitochondrial phosphate carrier with fatty acids and hydrophobic phosphate analogs.
Int. J. Biochem. Cell Biol. 32(5) , 499-508, (2000) Mitochondrial transporters, in particular uncoupling proteins and the ADP/ATP carrier, are known to mediate uniport of anionic fatty acids (FAs), allowing FA cycling which is completed by the passive ... |
|
|
Reactive oxygen species inhibit the succinate oxidation-supported generation of membrane potential in wheat mitochondria.
FEBS Lett. 516(1-3) , 15-9, (2002) In order to gain a first insight into the effects of reactive oxygen species (ROS) on plant mitochondria, we studied the effect of the ROS producing system consisting of xanthine plus xanthine oxidase... |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| SALYRGANIC ACID |
| Natrii mersalylas |
| Mersalylum acidum |
| EINECS 207-637-5 |
| Merasaly Acid |
| MFCD00004302 |
| Acidum mersalylicum |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of mersalyl acid? |
| A: LogP of mersalyl acid is 1.07400. |
| Q: What is the polar surface area (PSA) of mersalyl acid? |
| A: Polar surface area (PSA) of mersalyl acid is 105.09000. |
| Q: What English synonyms does mersalyl acid have? |
| A: English synonyms of mersalyl acid: SALYRGANIC ACID, Natrii mersalylas, Mersalylum acidum, EINECS 207-637-5, Merasaly Acid, MFCD00004302, Acidum mersalylicum. |
| Q: What is the CAS number of mersalyl acid? |
| A: CAS number of mersalyl acid is 486-67-9. |
| Q: What is the InChIKey of mersalyl acid? |
| A: InChIKey of mersalyl acid is GCUOGPZRDRUOAP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of mersalyl acid? |
| A: Molecular weight of mersalyl acid is 483.86700. |
| Q: What is the safety information for mersalyl acid? |
| A: Safety information for mersalyl acid: 13-28-36-45-60-61. |
| Q: What is the English name of mersalyl acid? |
| A: The English name of mersalyl acid is mersalyl acid. |
| Q: What is the molecular formula of mersalyl acid? |
| A: Molecular formula of mersalyl acid is C13H17HgNO6. |
| Q: How is the water solubility of mersalyl acid? |
| A: Water solubility of mersalyl acid: NH4OH: clear to hazy. |