b-D-Glucopyranoside, methyl,2,3,4,6-tetraacetate structure
|
Common Name | b-D-Glucopyranoside, methyl,2,3,4,6-tetraacetate | ||
|---|---|---|---|---|
| CAS Number | 4860-85-9 | Molecular Weight | 362.32900 | |
| Density | 1.27 g/cm3 | Boiling Point | 407.3ºC at 760 mmHg | |
| Molecular Formula | C15H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1ºC | |
| Name | Methyl .β.-D-glucopyranoside tetraacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27 g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760 mmHg |
| Molecular Formula | C15H22O10 |
| Molecular Weight | 362.32900 |
| Flash Point | 176.1ºC |
| Exact Mass | 362.12100 |
| PSA | 123.66000 |
| InChIKey | UYWUMFGDPBMNCA-UHFFFAOYSA-N |
| SMILES | COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| [3,5-diacetyloxy-2-(acetyloxymethyl)-6-methoxyoxan-4-yl] acetate |
| acetic acid [3,5-diacetoxy-2-(acetoxymethyl)-6-methoxy-tetrahydropyran-4-yl] ester |
| [3,5-diacetyloxy-2-(acetyloxymethyl)-6-methoxy-oxan-4-yl] ethanoate |