1-[(3-Bromophenyl)sulfonyl]-4-methylpiperazine structure
|
Common Name | 1-[(3-Bromophenyl)sulfonyl]-4-methylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 486422-19-9 | Molecular Weight | 319.218 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 413.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H15BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.8±31.5 °C | |
| Name | 1-(3-bromophenyl)sulfonyl-4-methylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 413.3±55.0 °C at 760 mmHg |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.218 |
| Flash Point | 203.8±31.5 °C |
| Exact Mass | 318.003754 |
| PSA | 49.00000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | XYSXYLKXIYXHPD-UHFFFAOYSA-N |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 |
| HS Code | 2933599090 |
|---|
|
~88%
1-[(3-Bromophen... CAS#:486422-19-9 |
| Literature: TargeGen, Inc. Patent: US2005/245524 A1, 2005 ; Location in patent: Page/Page column 40 ; US 20050245524 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Piperazine, 1-[(3-bromophenyl)sulfonyl]-4-methyl- |
| 1-[(3-Bromophenyl)sulfonyl]-4-methylpiperazine |
| 1-(3-bromophenylsulfonyl)-4-methylpiperazine |
| 1-(3-bromobenzenesulfonyl)-4-methylpiperazine |
| 1-(3-bromo-benzensulfonyl)-4-methyl-piperazine |
| C-2144 |