hematinic acid
hematinic acid structure
|
Common Name | hematinic acid | ||
|---|---|---|---|---|
| CAS Number | 487-65-0 | Molecular Weight | 183.16100 | |
| Density | 1.349g/cm3 | Boiling Point | 411.5ºC at 760mmHg | |
| Molecular Formula | C8H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.349g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760mmHg |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16100 |
| Flash Point | 202.7ºC |
| Exact Mass | 183.05300 |
| PSA | 86.96000 |
| LogP | 0.10000 |
| Vapour Pressure | 6.32E-08mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | ZAFOEDODWZIXMO-UHFFFAOYSA-N |
| SMILES | CC1=C(CCC(=O)O)C(=O)NC1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:21494-57-5
CAS#:14459-29-1
CAS#:17825-86-4
CAS#:766-39-2
CAS#:635-65-4
CAS#:1501-06-0
CAS#:487-66-1
CAS#:57-13-6
CAS#:20189-42-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| UNII-9R39KK1D4Y |
| 1H-Pyrrole-3-propanoic acid,2,5-dihydro-4-methyl-2,5-dioxo |
| Hematinic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: Related downstream products(CAS) of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid: 20189-42-8. |
| Q: What is the polar surface area (PSA) of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: Polar surface area (PSA) of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid is 86.96000. |
| Q: What is the SMILES notation of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: SMILES notation of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid is CC1=C(CCC(=O)O)C(=O)NC1=O. |
| Q: What English synonyms does 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid have? |
| A: English synonyms of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid: UNII-9R39KK1D4Y, 1H-Pyrrole-3-propanoic acid,2,5-dihydro-4-methyl-2,5-dioxo, Hematinic acid. |
| Q: What is the CAS number of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: CAS number of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid is 487-65-0. |
| Q: What is the Chinese name of 487-65-0? |
| A: Chinese name of 487-65-0 is 487-65-0. |
| Q: What is the molecular formula of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: Molecular formula of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid is C8H9NO4. |
| Q: What is the boiling point of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: Boiling point of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid is 411.5ºC at 760mmHg. |
| Q: What is the InChIKey of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: InChIKey of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid is ZAFOEDODWZIXMO-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid? |
| A: Related upstream materials(CAS) of 3-(4-methyl-2,5-dioxopyrrol-3-yl)propanoic acid: 21494-57-5;14459-29-1;17825-86-4;766-39-2;635-65-4;1501-06-0;487-66-1;57-13-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |