allyl toluene-4-sulfonate structure
|
Common Name | allyl toluene-4-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 4873-09-0 | Molecular Weight | 212.26500 | |
| Density | 1.166g/cm3 | Boiling Point | 319.2ºC at 760mmHg | |
| Molecular Formula | C10H12O3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 146.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | prop-2-enyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 319.2ºC at 760mmHg |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.26500 |
| Flash Point | 146.8ºC |
| Exact Mass | 212.05100 |
| PSA | 51.75000 |
| LogP | 2.96710 |
| Index of Refraction | n20/D 1.523 |
| InChIKey | ZSBJCQGJFPHZRC-UHFFFAOYSA-N |
| SMILES | C=CCOS(=O)(=O)c1ccc(C)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| allyl tosylate |
| allyl 4-methylbenzensulfonate |
| ALLYL TOLUENE-4-SULFONATE |
| allyl p-toluenesulfonate |
| Allyl p-toluenesulphonate |
| prop-2-en-1-yl 4-methylbenzenesulfonate |
| allyl 4-methylbenzenesulfonate |