5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione
![5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione Structure](https://image.chemsrc.com/caspic/017/4874-03-7.png)
5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione structure
|
Common Name | 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 4874-03-7 | Molecular Weight | 282.27600 | |
| Density | 1.461g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.461g/cm3 |
|---|---|
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.27600 |
| Exact Mass | 282.04200 |
| PSA | 156.74000 |
| Index of Refraction | 1.591 |
| InChIKey | NEEJFEFWZHXMJU-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cc(CSCc2c[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-[(2,4-dioxo-1... CAS#:4874-03-7 |
| Literature: The Brigham and women's Hospital, Inc. Patent: US2006/194821 A1, 2006 ; Location in patent: Page/Page column 22; sheet 14 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Bis-(thymyl)sulfid |
| Bis-thymin-5-yl-sulfid |
| 1H,1'H-5,5'-(2-thia-propane-1,3-diyl)-bis-pyrimidine-2,4-dione |
| di-{5-[1H-pyrimidine-2,4-dione]methyl}thioether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: InChIKey of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione is NEEJFEFWZHXMJU-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: Polar surface area (PSA) of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione is 156.74000. |
| Q: What are the upstream materials of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: Related upstream materials(CAS) of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione: 3590-48-5;4874-36-6. |
| Q: What is the molecular formula of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: Molecular formula of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione is C10H10N4O4S. |
| Q: What English synonyms does 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione have? |
| A: English synonyms of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione: Bis-(thymyl)sulfid, Bis-thymin-5-yl-sulfid, 1H,1'H-5,5'-(2-thia-propane-1,3-diyl)-bis-pyrimidine-2,4-dione, di-{5-[1H-pyrimidine-2,4-dione]methyl}thioether. |
| Q: What is the molecular weight of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: Molecular weight of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione is 282.27600. |
| Q: What is the Chinese name of 4874-03-7? |
| A: Chinese name of 4874-03-7 is 4874-03-7. |
| Q: What is the English name of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: The English name of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione is 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione. |
| Q: What is the CAS number of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: CAS number of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione is 4874-03-7. |
| Q: What is the SMILES notation of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione? |
| A: SMILES notation of 5-[(2,4-dioxo-1H-pyrimidin-5-yl)methylsulfanylmethyl]-1H-pyrimidine-2,4-dione is O=c1[nH]cc(CSCc2c[nH]c(=O)[nH]c2=O)c(=O)[nH]1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |