5-(chloromethyl)uracil structure
|
Common Name | 5-(chloromethyl)uracil | ||
|---|---|---|---|---|
| CAS Number | 3590-48-5 | Molecular Weight | 160.55800 | |
| Density | 1.393g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H5ClN2O2 | Melting Point | >350ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(chloromethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Melting Point | >350ºC(lit.) |
| Molecular Formula | C5H5ClN2O2 |
| Molecular Weight | 160.55800 |
| Exact Mass | 160.00400 |
| PSA | 65.72000 |
| Appearance of Characters | Powder |
| Index of Refraction | 1.511 |
| InChIKey | UCDUBKRXOPMNGH-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cc(CCl)c(=O)[nH]1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~99%
5-(chloromethyl... CAS#:3590-48-5 |
| Literature: Maduskuie, Thomas P. Patent: US2003/229081 A1, 2003 ; Location in patent: Page 14; 17 ; |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chlormethyl-1H-pyrimidin-2,4-dion |
| 5-(chloromethyl)-1,3-dihydropyrimidine-2,4-dione |
| 5-Chlor-methyluracil |
| MFCD00218445 |
| 5-(chloromethyl)pyrimidine-2,4(1h,3h)-dione |
| 5-chloromethyl-1H-pyrimidine-2,4-dione |
| 5-(chloromethyl)-2,4(1H,3H)-pyrimidinedione |
| 5-(Chloromethyl)uracil |