3,5-bis(methylsulfonyl)thiazole-4-carbonitrile structure
|
Common Name | 3,5-bis(methylsulfonyl)thiazole-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 4886-22-0 | Molecular Weight | 266.31800 | |
| Density | 1.71g/cm3 | Boiling Point | 505.1ºC at 760 mmHg | |
| Molecular Formula | C6H6N2O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.3ºC | |
| Name | 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Boiling Point | 505.1ºC at 760 mmHg |
| Molecular Formula | C6H6N2O4S3 |
| Molecular Weight | 266.31800 |
| Flash Point | 259.3ºC |
| Exact Mass | 265.94900 |
| PSA | 149.96000 |
| LogP | 1.98338 |
| Index of Refraction | 1.616 |
| InChIKey | RIGYMANZYXBOTR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nsc(S(C)(=O)=O)c1C#N |
|
~59%
3,5-bis(methyls... CAS#:4886-22-0 |
| Literature: Kislitsyn; Kucherov; Chukhrov; Zlotin; Starikova; Dolgushin Russian Chemical Bulletin, 2004 , vol. 53, # 4 p. 916 - 924 |
|
~%
3,5-bis(methyls... CAS#:4886-22-0 |
| Literature: Hatchard,W.R. Journal of Organic Chemistry, 1964 , vol. 29, p. 665 - 668 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3.5-Dimethylsulfonyl-4-cyan-isothiazol |
| HMS1612K02 |
| 3,5-bis-methanesulfonyl-isothiazole-4-carbonitrile |