4-(4,5-diphenyl-1,3-dihydroimidazol-2-ylidene)-3-hydroxycyclohexa-2,5-dien-1-one structure
|
Common Name | 4-(4,5-diphenyl-1,3-dihydroimidazol-2-ylidene)-3-hydroxycyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 488787-64-0 | Molecular Weight | 328.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4,5-diphenyl-1,3-dihydroimidazol-2-ylidene)-3-hydroxycyclohexa-2,5-dien-1-one |
|---|
| Molecular Formula | C21H16N2O2 |
|---|---|
| Molecular Weight | 328.36400 |
| Exact Mass | 328.12100 |
| PSA | 68.88000 |
| LogP | 3.68940 |
| InChIKey | YKZFBYGKWSTWIZ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(O)c1 |
|
~95%
4-(4,5-diphenyl... CAS#:488787-64-0 |
| Literature: Shaterian; Ranjbar; Azizi Journal of the Iranian Chemical Society, 2011 , vol. 8, # 4 p. 1120 - 1134 |
|
~92%
4-(4,5-diphenyl... CAS#:488787-64-0 |
| Literature: Shaterian; Ranjbar; Azizi Journal of the Iranian Chemical Society, 2011 , vol. 8, # 4 p. 1120 - 1134 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |