ORM-10103 structure
|
Common Name | ORM-10103 | ||
|---|---|---|---|---|
| CAS Number | 488847-28-5 | Molecular Weight | 348.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of ORM-10103ORM-10103 is a specific inhibitor of the Na+/Ca2+ exchanger (NCX), which decreases the NCX current with estimated IC50s of 55 and 67 nM at -80 and at 20 mV, respectively[1][2]. |
| Name | 5-nitro-2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine |
|---|
| Description | ORM-10103 is a specific inhibitor of the Na+/Ca2+ exchanger (NCX), which decreases the NCX current with estimated IC50s of 55 and 67 nM at -80 and at 20 mV, respectively[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 55 (NCX -80 mV ), 67 nM (NCX 20 mV)[2] |
| References |
| Molecular Formula | C20H16N2O4 |
|---|---|
| Molecular Weight | 348.35 |
| Exact Mass | 348.11100 |
| PSA | 77.17000 |
| LogP | 5.37160 |
| InChIKey | GZONLGPIHCCJOI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc3c(c2)CCC(c2ccccc2)O3)nc1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H413 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |