Aromadendrene structure
|
Common Name | Aromadendrene | ||
|---|---|---|---|---|
| CAS Number | 489-39-4 | Molecular Weight | 204.35 | |
| Density | 0.93g/cm3 | Boiling Point | 261-263ºC(lit.) | |
| Molecular Formula | C15H24 | Melting Point | 262ºC | |
| MSDS | Chinese USA | Flash Point | 106.5ºC | |
Use of AromadendreneAromadendrene can be isolated from Eucalyptus globulus. Aromadendrene has antimicrobial activity[1]. |
| Name | (+)-aromadendrene |
|---|---|
| Synonym | More Synonyms |
| Description | Aromadendrene can be isolated from Eucalyptus globulus. Aromadendrene has antimicrobial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.93g/cm3 |
|---|---|
| Boiling Point | 261-263ºC(lit.) |
| Melting Point | 262ºC |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| Flash Point | 106.5ºC |
| Exact Mass | 204.18800 |
| LogP | 4.27090 |
| Index of Refraction | n20/D 1.497 |
| InChIKey | ITYNGVSTWVVPIC-XVIXHAIJSA-N |
| SMILES | C=C1CCC2C(C3C(C)CCC13)C2(C)C |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard Codes | F |
| WGK Germany | 3 |
|
C.G.J.M. Seelen et al.
Tetrahedron 46 , 7237, (1990)
|
|
|
H.J.M. Gijsen et al.
Tetrahedron 50 , 4745, (1994)
|
| EINECS 207-694-6 |
| alloaromadendrene |
| aromadenderene |
| aromandendrene |
| MFCD00062951 |