Naphthalene, 1-methoxy-4-nitro structure
|
Common Name | Naphthalene, 1-methoxy-4-nitro | ||
|---|---|---|---|---|
| CAS Number | 4900-63-4 | Molecular Weight | 203.19400 | |
| Density | 1.274g/cm3 | Boiling Point | 367.2ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | 83-85ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 178.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-methoxy-4-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 367.2ºC at 760 mmHg |
| Melting Point | 83-85ºC(lit.) |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 178.3ºC |
| Exact Mass | 203.05800 |
| PSA | 55.05000 |
| LogP | 3.27980 |
| Index of Refraction | 1.638 |
| InChIKey | YFJKGPRYPHFGQD-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c2ccccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00003926 |
| EINECS 225-528-0 |
| 1-nitro-4-methoxynaphthalene |
| 4-nitro-1-methoxynaphthalene |
| Naphthalene,1-methoxy-4-nitro |
| 4-methoxy-1-nitro-naphthalene |
| 1-methoxy-4-nitro-naphthalene |