2,4-dihydroxy-6-pentylbenzoic acid structure
|
Common Name | 2,4-dihydroxy-6-pentylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 491-72-5 | Molecular Weight | 224.25300 | |
| Density | 1.237g/cm3 | Boiling Point | 403.9ºC at 760 mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.2ºC | |
Use of 2,4-dihydroxy-6-pentylbenzoic acidOlivetolic acid is an analytical reference standard, and an intermediate in the phytocannabinoid biosynthetic pathway. |
| Name | olivetolic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760 mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25300 |
| Flash Point | 212.2ºC |
| Exact Mass | 224.10500 |
| PSA | 77.76000 |
| LogP | 2.52870 |
| Vapour Pressure | 3.01E-07mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | SXFKFRRXJUJGSS-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc(O)cc(O)c1C(=O)O |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| 2,4-Dihydroxy-6-pentyl-benzoesaeure |
| benzoic acid,2,4-dihydroxy-6-pentyl |
| Allazetolcarboxylic acid |
| 2,4-dihydroxy-6-pentylbenzoic acid |
| olivetolcarboxylic acid |
| Olivetolcarbonsaeure |
| Olivetolic acid |
| 2,4-dihydroxy-6-pentylbenzoate |
| 2,4-dihydroxy-6-pentyl-benzoic acid |
| Olivetolate |