perlatolinic acid
Modify Date: 2025-12-01 08:23:58
perlatolinic acid structure
|
Common Name | perlatolinic acid | ||
|---|---|---|---|---|
| CAS Number | 529-47-5 | Molecular Weight | 444.51700 | |
| Density | 1.198g/cm3 | Boiling Point | 613ºC at 760mmHg | |
| Molecular Formula | C25H32O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.7ºC | |
| Name | 2-hydroxy-4-(2-hydroxy-4-methoxy-6-pentylbenzoyl)oxy-6-pentylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 613ºC at 760mmHg |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.51700 |
| Flash Point | 202.7ºC |
| Exact Mass | 444.21500 |
| PSA | 113.29000 |
| LogP | 5.48920 |
| Index of Refraction | 1.572 |
| InChIKey | UTAQXQVSEKIWBB-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc(OC(=O)c2c(O)cc(OC)cc2CCCCC)cc(O)c1C(=O)O |
| HS Code | 2918990090 |
|---|
CAS#:52189-68-1
CAS#:500-66-3
CAS#:491-72-5![4-[(2,4-Dimethoxy-6-pentylbenzoyl)oxy]-2-methoxy-6-pentylbenzoic acid methyl ester structure](https://image.chemsrc.com/caspic/191/5366-08-5.png)
CAS#:5366-08-5
CAS#:58016-28-7| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of mPGES1 in human A549 cell microsomal membrane using pGH2 as substrate p...
Source: ChEMBL
Target: Prostaglandin E synthase
External Id: CHEMBL4152535
|
Total 2, Current Page 1 of 1
1
| perlatolic acid |
| Perlatolsaeure |
| perlatolinic acid |
| 2-Hydroxy-4-(2-hydroxy-4-methoxy-6-pentyl-benzoyloxy)-6-pentyl-benzoesaeure |
| perlatoric acid |
| 2-Hydroxy-4-((2-hydroxy-4-methoxy-6-pentylbenzoyl)oxy)-6-pentylbenzoic acid |