4-methoxytetrafluorobenzyl bromide structure
|
Common Name | 4-methoxytetrafluorobenzyl bromide | ||
|---|---|---|---|---|
| CAS Number | 4910-40-1 | Molecular Weight | 273.02200 | |
| Density | 1.708g/cm3 | Boiling Point | 213.5ºC at 760mmHg | |
| Molecular Formula | C8H5BrF4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.8ºC | |
| Name | 4-methoxytetrafluorobenzyl bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.708g/cm3 |
|---|---|
| Boiling Point | 213.5ºC at 760mmHg |
| Molecular Formula | C8H5BrF4O |
| Molecular Weight | 273.02200 |
| Flash Point | 101.8ºC |
| Exact Mass | 271.94600 |
| PSA | 9.23000 |
| LogP | 3.14650 |
| Index of Refraction | 1.482 |
| InChIKey | SNPXIYPEWUELMV-UHFFFAOYSA-N |
| SMILES | COc1c(F)c(F)c(CBr)c(F)c1F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 1760 |
| HS Code | 2909309090 |
|
~%
4-methoxytetraf... CAS#:4910-40-1 |
| Literature: Filler,R. et al. Journal of Organic Chemistry, 1969 , vol. 34, # 3 p. 534 - 538 |
|
~%
4-methoxytetraf... CAS#:4910-40-1 |
| Literature: Filler,R. et al. Journal of Organic Chemistry, 1969 , vol. 34, # 3 p. 534 - 538 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3,5,6-TETRAFLUORO-4-METHOXYBENZYL BROMIDE |
| 2,3,4,5-TETRAFLUOROBENZOYL CHLORID |
| 4-Methoxytetrafluorobenzylbromide |
| MFCD00153200 |
| 4-Methoxy-2,3,5,6-tetrafluorobenzyl bromide |
| 4-Methoxy-2,3,5,6-tetrafluor-benzylbromid |