2, 6-Dimethyl-4-nitropyridine structure
|
Common Name | 2, 6-Dimethyl-4-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 4913-57-9 | Molecular Weight | 152.151 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 253.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O2 | Melting Point | 47℃ | |
| MSDS | N/A | Flash Point | 107.0±25.9 °C | |
| Name | 2,6-Dimethyl-4-Nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 253.4±35.0 °C at 760 mmHg |
| Melting Point | 47℃ |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.151 |
| Flash Point | 107.0±25.9 °C |
| Exact Mass | 152.058578 |
| PSA | 58.71000 |
| LogP | 1.25 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | OLERZURONBJUJK-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)n1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
|
~61%
2, 6-Dimethyl-4... CAS#:4913-57-9 |
| Literature: Zohuri, Gholam Hossein; Seyedi, Seyed Mohammad; Sandaroos, Reza; Damavandi, Saman; Mohammadi, Ali Catalysis Letters, 2010 , vol. 140, # 3-4 p. 160 - 166 |
|
~%
2, 6-Dimethyl-4... CAS#:4913-57-9 |
| Literature: Zohuri, Gholam Hossein; Seyedi, Seyed Mohammad; Sandaroos, Reza; Damavandi, Saman; Mohammadi, Ali Catalysis Letters, 2010 , vol. 140, # 3-4 p. 160 - 166 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2,6-dimethyl-4-nitro- |
| 2,6-Dimethyl-4-nitropyridine |