(4-amino-3-chloro-phenyl)-phenyl-methanone structure
|
Common Name | (4-amino-3-chloro-phenyl)-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 4913-75-1 | Molecular Weight | 231.67800 | |
| Density | 1.274g/cm3 | Boiling Point | 398.3ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.7ºC | |
| Name | (4-amino-3-chlorophenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 398.3ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.67800 |
| Flash Point | 194.7ºC |
| Exact Mass | 231.04500 |
| PSA | 43.09000 |
| LogP | 3.73440 |
| Index of Refraction | 1.636 |
| InChIKey | LMYUWPOFHRFDHX-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2ccccc2)cc1Cl |
|
~%
(4-amino-3-chlo... CAS#:4913-75-1 |
| Literature: Chattaway Journal of the Chemical Society, 1904 , vol. 85, p. 342 |
|
~%
(4-amino-3-chlo... CAS#:4913-75-1 |
| Literature: Dippy; Moss Journal of the Chemical Society, 1952 , p. 2205,2207, 2209 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Chloro-4-aminobenzophenone |
| 4-amino-3-chlorobenzohenone |
| 3-Chlor-4-amino-benzophenon |
| 4-amino-3-chloro-benzophenone |
| 4-Amino-3-chlor-benzophenon |