4-Amino-3-nitrobenzophenone structure
|
Common Name | 4-Amino-3-nitrobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 31431-19-3 | Molecular Weight | 242.230 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 449.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H10N2O3 | Melting Point | 140-143 °C(lit.) | |
| MSDS | N/A | Flash Point | 225.8±25.9 °C | |
| Name | 4-Amino-3-nitrobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.7±35.0 °C at 760 mmHg |
| Melting Point | 140-143 °C(lit.) |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.230 |
| Flash Point | 225.8±25.9 °C |
| Exact Mass | 242.069138 |
| PSA | 88.91000 |
| LogP | 3.42 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | NGOOFAMQPUEDJM-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2ccccc2)cc1[N+](=O)[O-] |
| Water Solubility | 10 mg/L (20 ºC) |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2922399090 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Amino-3-nitro-benzophenon |
| Methanone, (4-amino-3-nitrophenyl)phenyl- |
| 3-nitro-4-aminobenzophenone |
| 4-AMINO-3-NITROBENZOPHENONE= |
| 4-Amino-3-nitrobenzophenone |
| (4-Amino-3-nitrophenyl)(phenyl)methanone |
| 2-nitro-4-benzoylaniline |
| MFCD00007154 |
| EINECS 250-631-2 |