Butin structure
|
Common Name | Butin | ||
|---|---|---|---|---|
| CAS Number | 492-14-8 | Molecular Weight | 272.253 | |
| Density | 1.485 | Boiling Point | 582.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O5 | Melting Point | 224-226ºC | |
| MSDS | N/A | Flash Point | 226.7±23.6 °C | |
Use of Butin(-)-Butin is the S enantiomer of Butin. Butin is a major biologically active flavonoid isolated from the heartwood of Dalbergia odorifera, with strong antioxidant, antiplatelet and anti-inflammatory activities[1][2]. |
| Name | butin |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Butin is the S enantiomer of Butin. Butin is a major biologically active flavonoid isolated from the heartwood of Dalbergia odorifera, with strong antioxidant, antiplatelet and anti-inflammatory activities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.485 |
|---|---|
| Boiling Point | 582.4±50.0 °C at 760 mmHg |
| Melting Point | 224-226ºC |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.253 |
| Flash Point | 226.7±23.6 °C |
| Exact Mass | 272.068481 |
| PSA | 86.99000 |
| LogP | 2.16 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | MJBPUQUGJNAPAZ-AWEZNQCLSA-N |
| SMILES | O=C1CC(c2ccc(O)c(O)c2)Oc2cc(O)ccc21 |
| Hazard Codes | Xi |
|---|
| 5-Deoxyeriodictyol |
| (-)-butin |
| (2S)-2-(3,4-Dihydroxyphenyl)-7-hydroxy-2,3-dihydro-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, (2S)- |
| 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, (S)- |
| 7,3',4'-Trihydroxyflavanone |
| (2S)-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
| Butin |
| 3',4',7-Trihydroxyflavanone |