LPK-26 structure
|
Common Name | LPK-26 | ||
|---|---|---|---|---|
| CAS Number | 492451-07-7 | Molecular Weight | 391.76 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 478.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H24Cl2N2O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 242.9±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | LPK-26 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.0±45.0 °C at 760 mmHg |
| Molecular Formula | C18H24Cl2N2O |
| Molecular Weight | 391.76 |
| Flash Point | 242.9±28.7 °C |
| Exact Mass | 354.126556 |
| LogP | 4.00 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | WOOCHAFXTYNYQE-UNTBIKODSA-N |
| SMILES | CC(C)C(CN1CC=CC1)N(C)C(=O)Cc1ccc(Cl)c(Cl)c1.Cl |
| Water Solubility | Soluble in a minimum of 10 mg/mL water |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 2-(3,4-Dichlorophenyl)-N-[(2S)-1-(2,5-dihydro-1H-pyrrol-1-yl)-3-methyl-2-butanyl]-N-methylacetamide |
| LPK-26 |
| 2-(3,4-Dichlorophenyl)-N-methyl-N-[(1S)-1-(2-isopropyl)-2-(1-(3-pyrrolinyl))ethyl]acetamide hydrochloride |
| 2-(3,4-dichlorophenyl)-N-[(2S)-1-(2,5-dihydro-1H-pyrrol-1-yl)-3-methylbutan-2-yl]-N-methylacetamide |
| Benzeneacetamide, 3,4-dichloro-N-[(1S)-1-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]-2-methylpropyl]-N-methyl- |