3-Cyclohexyl-1H-indole-6-carboxylic acid structure
|
Common Name | 3-Cyclohexyl-1H-indole-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 494799-17-6 | Molecular Weight | 243.301 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 486.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.9±23.2 °C | |
| Name | 3-cyclohexyl-1H-indole-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.3±25.0 °C at 760 mmHg |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.301 |
| Flash Point | 247.9±23.2 °C |
| Exact Mass | 243.125931 |
| PSA | 53.09000 |
| LogP | 4.34 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | OZJSQVKDKOOQIT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c[nH]c2c1 |
| HS Code | 2933990090 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-6-carboxylic acid, 3-cyclohexyl- |
| 3-Cyclohexylindole-6-carboxylic acid |
| 1H-Indole-6-carboxylic acid,3-cyclohexyl |
| 3-cyclohexyl-6-indole carboxylic acid |
| 3-cyclohexyl-1H-indole-6-carboxylicacid |
| 3-Cyclohexyl-1H-indole-6-carboxylic acid |