methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate structure
|
Common Name | methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 494799-19-8 | Molecular Weight | 336.22400 | |
| Density | 1.417g/cm3 | Boiling Point | 458ºC at 760 mmHg | |
| Molecular Formula | C16H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.8ºC | |
| Name | methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 458ºC at 760 mmHg |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.22400 |
| Flash Point | 230.8ºC |
| Exact Mass | 335.05200 |
| PSA | 42.09000 |
| LogP | 4.76470 |
| Index of Refraction | 1.625 |
| InChIKey | QOQJFUQDXVNLMK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(Br)[nH]c2c1 |
| HS Code | 2933990090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-bromo-3-cyclohexyl-2-1H-indole-6-carboxylate |
| 2-bromo-3-cyclohexylindole-6-carboxylic acid methyl ester |
| 2-bromo-3-cyclohexyl-1H-indole-6-carboxylic acid methyl ester |
| methyl 2-bromo-3-cyclohexylindole-6-carboxylate |
| METHYL 2-BROMO-3-CYCLOHEXYL-6-INDOLECARBOXYLATE |