fentoxan structure
|
Common Name | fentoxan | ||
|---|---|---|---|---|
| CAS Number | 495-48-7 | Molecular Weight | 198.221 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 336.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H10N2O | Melting Point | 32-36 °C | |
| MSDS | Chinese USA | Flash Point | 157.0±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | azoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 336.0±25.0 °C at 760 mmHg |
| Melting Point | 32-36 °C |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.221 |
| Flash Point | 157.0±23.2 °C |
| Exact Mass | 198.079315 |
| PSA | 41.11000 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | GAUZCKBSTZFWCT-UHFFFAOYSA-N |
| SMILES | [O-][N+](=Nc1ccccc1)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H332 |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/22 |
| Safety Phrases | S28A-S28 |
| RIDADR | NONH for all modes of transport |
| RTECS | CO4025000 |
| HS Code | 2927000090 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Reduction of nitroarenes to azoxybenzenes by potassium borohydride in water.
Molecules 16 , 3563-3568, (2011) The synthesis of the azoxybenzenes by the reduction of nitroarenes with reducing agent potassium borohydride in water was reported for the first time. PEG-400 was used as a phase transfer catalyst and... |
|
|
[A case of suicide suspected of poisoning from taking some agricultural chemicals].
Nihon Hoigaku. Zasshi 45(2) , 158-65, (1991) Forensic toxicological examination was performed on a person who was suspected of poisoning by Azomite emulsion (an acaricide), Roundup (a herbicide) and/or unidentified agricultural chemical and died... |
|
|
[Distribution and metabolism of azoxybenzene in the rat].
Z. Gesamte Hyg. 35(5) , 255-7, (1989) No sex differences could been shown after absorption and distribution of azoxybenzen in the rat. The highest level occur in the thyroid gland, the adrenals and in the fat tissues. The maximum level wa... |
| fentoxan |
| Azoxybenzene,Fenazox |
| 1,2-diphenyldiazene oxide |
| Diazene,diphenyl-,1-oxide |
| Diphenyldiazene oxide |
| MFCD00019925 |
| Azobenzene,oxide |
| 2-oxo-1,2-diphenylhydrazin-2-ium-1-ide |
| Azane, oxidophenyl(phenylazanylidene)-, (Z)- |
| azoxybenzide |
| EINECS 207-802-1 |
| Diphenyldiazene 1-oxide |
| [(Z)-Phenyl-NNO-azoxy]benzene |
| oxido-phenyl-phenyliminoazanium |
| Fenazox |
| Azoxybenzol |
| Benzene,azoxydi |
| azoxybenzene |
| Diazene, diphenyl-, 1-oxide |