3-NITROTYRAMINE structure
|
Common Name | 3-NITROTYRAMINE | ||
|---|---|---|---|---|
| CAS Number | 49607-15-0 | Molecular Weight | 182.17700 | |
| Density | 1.338g/cm3 | Boiling Point | 326.785ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.434ºC | |
| Name | 4-(2-aminoethyl)-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 326.785ºC at 760 mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.17700 |
| Flash Point | 151.434ºC |
| Exact Mass | 182.06900 |
| PSA | 92.07000 |
| LogP | 2.02510 |
| Index of Refraction | 1.619 |
| InChIKey | IUCYCHQMRZWPGT-UHFFFAOYSA-N |
| SMILES | NCCc1ccc(O)c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-hydroxy-3-nitrophenethylamine |
| 3-Nitro-tyramin |
| 3-Nitrotyramine |