(2S)-2-{[(Benzyloxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]- 8-oxooctanoic acid-N-cyclohexylcyclohexanamine (1:1) structure
|
Common Name | (2S)-2-{[(Benzyloxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]- 8-oxooctanoic acid-N-cyclohexylcyclohexanamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 49645-27-4 | Molecular Weight | 560.76500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H52N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-{[(Benzyloxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]- 8-oxooctanoic acid-N-cyclohexylcyclohexanamine (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H52N2O6 |
|---|---|
| Molecular Weight | 560.76500 |
| Exact Mass | 560.38300 |
| PSA | 117.45000 |
| LogP | 7.49490 |
| InChIKey | XLQYLRMNEDDXJX-UHFFFAOYSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)CCCCCC(NC(=O)OCc1ccccc1)C(=O)O |
|
~%
(2S)-2-{[(Benzy... CAS#:49645-27-4 |
| Literature: Attenni, Barbara; Ferrigno, Federica; Jones, Philip; Ingenito, Raffaele; Kinzel, Olaf; Llauger Bufi, Laura; Ontoria, Jesus Maria; Pescatore, Giovanna; Rowley, Michael; Scarpelli, Rita; Schultz, Carsten Patent: US2009/48228 A1, 2009 ; Location in patent: Page/Page column 90 ; US 20090048228 A1 |
|
~%
(2S)-2-{[(Benzy... CAS#:49645-27-4 |
| Literature: Kobayashi,A. et al. Bulletin of the Chemical Society of Japan, 1969 , vol. 42, # 12 p. 3491 - 3495 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Z-L-Ala-L-Val-OMe |
| Z-Ala-Val-OMe |
| Cbz-Ala-Val-OMe |
| (S)-2-(((benzyloxy)carbonyl)amino)-8-(tert-butoxy)-8-oxooctanoic acid |
| N-CBZ-L-Ala-Val Methyl ester |
| N-Carbobenzoxy-L-alanyl-L-valine Methyl Ester |
| Z-L-alanyl-L-valine methyl ester |
| Z-L-Asu(OtBu) |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-8-tert-butoxy-8-oxooctanoic acid |