Nigerose structure
|
Common Name | Nigerose | ||
|---|---|---|---|---|
| CAS Number | 497-48-3 | Molecular Weight | 342.29600 | |
| Density | 1.68g/cm3 | Boiling Point | 790.1ºC at 760mmHg | |
| Molecular Formula | C12H22O11 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 294.4ºC | |
Use of NigeroseNigerose is a disaccharide[1]. |
| Name | nigerose |
|---|---|
| Synonym | More Synonyms |
| Description | Nigerose is a disaccharide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 790.1ºC at 760mmHg |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.29600 |
| Flash Point | 294.4ºC |
| Exact Mass | 342.11600 |
| PSA | 189.53000 |
| Vapour Pressure | 7.42E-29mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | QIGJYVCQYDKYDW-NSYYTRPSSA-N |
| SMILES | OCC1OC(OC2C(O)C(O)OC(CO)C2O)C(O)C(O)C1O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
|
Differentiation of Disaccharide Isomers by Temperature-Dependent In-Source Decay (TDISD) and DART-Q-TOF MS/MS.
J. Am. Soc. Mass Spectrom. 26 , 1599-605, (2015) Helium direct analysis in real time (He-DART) mass spectrometry (MS) of some compounds, polysaccharides, for example, usually tends to be challenging because of the occurrence of prominent in-source d... |
| 3-O-|A-D-glucopyranosyl-D-glucose |
| 3)-D-Glup |
| 3)-D-glucopyranose |
| MFCD00057489 |
| (3R,4S,5R,6R)-6-(hydroxymethyl)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,5-triol |
| 3)-D-Glu |
| Nigerose |
| Sakebiose |