3-hydroxy-4-oxopyran-2,6-dicarboxylic acid structure
|
Common Name | 3-hydroxy-4-oxopyran-2,6-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 497-59-6 | Molecular Weight | 200.10200 | |
| Density | 2.043g/cm3 | Boiling Point | 353.8ºC at 760mmHg | |
| Molecular Formula | C7H4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.8ºC | |
| Name | 3-hydroxy-4-oxopyran-2,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.043g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760mmHg |
| Molecular Formula | C7H4O7 |
| Molecular Weight | 200.10200 |
| Flash Point | 149.8ºC |
| Exact Mass | 199.99600 |
| PSA | 125.04000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | ZEGRKMXCOCRTCS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)c(O)c(C(=O)O)o1 |
|
~%
3-hydroxy-4-oxo... CAS#:497-59-6 |
| Literature: Lovell, Scott; Subramony, Paramjeet; Kahr, Bart Journal of the American Chemical Society, 1999 , vol. 121, # 30 p. 7020 - 7025 |
|
~29%
3-hydroxy-4-oxo... CAS#:497-59-6 |
| Literature: Lovell, Scott; Subramony, Paramjeet; Kahr, Bart Journal of the American Chemical Society, 1999 , vol. 121, # 30 p. 7020 - 7025 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibitory potency against NS5B HCV polymerase
Source: ChEMBL
Target: RNA-directed RNA polymerase
External Id: CHEMBL750253
|
|
Name: Tested for inhibition of HCV RNA replication in a cell-basedassay; No significant inh...
Source: ChEMBL
Target: Hepacivirus hominis
External Id: CHEMBL691893
|
| Meconic acid |
| 3-HYDROXY-4-OXO-4H-PYRAN-2,6-DICARBOXYLIC ACID |
| 2,6-Dicarboxy-3-hydroxy-<4>pyron |
| 3-Hydroxy-4-oxo-1,4-pyran-2,6-dicarboxylic acid |
| Poppy acid |