diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate structure
|
Common Name | diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 49713-39-5 | Molecular Weight | 331.28700 | |
| Density | 1.282g/cm3 | Boiling Point | 343.9ºC at 760 mmHg | |
| Molecular Formula | C15H16F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.8ºC | |
| Name | diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate |
|---|
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 343.9ºC at 760 mmHg |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.28700 |
| Flash Point | 161.8ºC |
| Exact Mass | 331.10300 |
| PSA | 64.63000 |
| LogP | 3.20040 |
| Index of Refraction | 1.505 |
| InChIKey | JJXDEKZGHIXHPA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNc1ccc(C(F)(F)F)cc1)C(=O)OCC |
|
~95%
diethyl 2-[[4-(... CAS#:49713-39-5 |
| Literature: Niedermeier, Sabine; Singethan, Katrin; Rohrer, Sebastian G.; Matz, Magnus; Kossner, Markus; Diederich, Sandra; Maisner, Andrea; Schmitz, Jens; Hiltensperger, Georg; Baumann, Knut; Holzgrabe, Ulrike; Schneider-Schaulies, Jurgen Journal of Medicinal Chemistry, 2009 , vol. 52, # 14 p. 4257 - 4265 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |