N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine
Modify Date: 2026-08-23 16:37:14
![N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine Structure](https://www.chemsrc.com/extcaspic/279/4976-44-7.png)
N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine structure
|
Common Name | N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 4976-44-7 | Molecular Weight | 311.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H29N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H29N3 |
|---|---|
| Molecular Weight | 311.5 |
| InChIKey | GFRVBKKDZPHTMO-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(Nc2ccc(N(CC)CC)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine? |
| A: SMILES notation of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine is CCN(CC)c1ccc(Nc2ccc(N(CC)CC)cc2)cc1. |
| Q: What is the molecular formula of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine? |
| A: Molecular formula of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine is C20H29N3. |
| Q: What is the InChIKey of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine? |
| A: InChIKey of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine is GFRVBKKDZPHTMO-UHFFFAOYSA-N. |
| Q: What is the CAS number of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine? |
| A: CAS number of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine is 4976-44-7. |
| Q: What is the Chinese name of 4976-44-7? |
| A: Chinese name of 4976-44-7 is 4976-44-7. |
| Q: What is the English name of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine? |
| A: The English name of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine is N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine. |
| Q: What is the molecular weight of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine? |
| A: Molecular weight of N'-[4-(diethylamino)phenyl]-N,N-diethylbenzene-1,4-diamine is 311.5. |