Z-L-Ala-Gly-NH2
Z-L-Ala-Gly-NH2 structure
|
Common Name | Z-L-Ala-Gly-NH2 | ||
|---|---|---|---|---|
| CAS Number | 4976-59-4 | Molecular Weight | 279.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | z-ala-gly-nh2 |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17N3O4 |
|---|---|
| Molecular Weight | 279.29200 |
| Exact Mass | 279.12200 |
| PSA | 110.52000 |
| LogP | 1.38490 |
| InChIKey | YUWYAVYBKJFYPK-SECBINFHSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NCC(N)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![L-Alanine, N-[(phenylmethoxy)carbonyl]-, phenylmethyl ester structure](https://image.chemsrc.com/caspic/168/88718-12-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Z-L-Ala-Gly-NH2 |
| CBZ-L-alanylglycinamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of z-ala-gly-nh2? |
| A: Molecular formula of z-ala-gly-nh2 is C13H17N3O4. |
| Q: What is the InChIKey of z-ala-gly-nh2? |
| A: InChIKey of z-ala-gly-nh2 is YUWYAVYBKJFYPK-SECBINFHSA-N. |
| Q: What is the English name of z-ala-gly-nh2? |
| A: The English name of z-ala-gly-nh2 is z-ala-gly-nh2. |
| Q: What is the LogP of z-ala-gly-nh2? |
| A: LogP of z-ala-gly-nh2 is 1.38490. |
| Q: What is the molecular weight of z-ala-gly-nh2? |
| A: Molecular weight of z-ala-gly-nh2 is 279.29200. |
| Q: What is the SMILES notation of z-ala-gly-nh2? |
| A: SMILES notation of z-ala-gly-nh2 is CC(NC(=O)OCc1ccccc1)C(=O)NCC(N)=O. |
| Q: What is the Chinese name of 4976-59-4? |
| A: Chinese name of 4976-59-4 is 4976-59-4. |
| Q: What is the CAS number of z-ala-gly-nh2? |
| A: CAS number of z-ala-gly-nh2 is 4976-59-4. |
| Q: What is the polar surface area (PSA) of z-ala-gly-nh2? |
| A: Polar surface area (PSA) of z-ala-gly-nh2 is 110.52000. |
| Q: What are the upstream materials of z-ala-gly-nh2? |
| A: Related upstream materials(CAS) of z-ala-gly-nh2: 1668-10-6;88718-12-1;1142-20-7;28819-05-8;4816-87-9;598-41-4. |