methyl 2-[[4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoate structure
|
Common Name | methyl 2-[[4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 4976-86-7 | Molecular Weight | 427.45000 | |
| Density | 1.263g/cm3 | Boiling Point | 718.8ºC at 760 mmHg | |
| Molecular Formula | C22H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.5ºC | |
| Name | methyl 2-[[4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 718.8ºC at 760 mmHg |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.45000 |
| Flash Point | 388.5ºC |
| Exact Mass | 427.17400 |
| PSA | 136.82000 |
| LogP | 2.53940 |
| Index of Refraction | 1.573 |
| InChIKey | XHINWMJGDYTIFM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(CC(N)=O)NC(=O)OCc1ccccc1 |
|
~87%
methyl 2-[[4-am... CAS#:4976-86-7 |
| Literature: Tai, Dar-Fu; Fu, Shu-Lin Journal of the Chinese Chemical Society, 2003 , vol. 50, # 1 p. 179 - 183 |
|
~88%
methyl 2-[[4-am... CAS#:4976-86-7 |
| Literature: Hartrodt; Neubert; Jakubke; Balaspiri; Telegdy Pharmazie, 1982 , vol. 37, # 6 p. 403 - 407 |
|
~77%
methyl 2-[[4-am... CAS#:4976-86-7 |
| Literature: Pavo; Penke; Varga; et al. Acta Chimica Hungarica, 1986 , vol. 122, # 3-4 p. 261 - 272 |
|
~75%
methyl 2-[[4-am... CAS#:4976-86-7 |
| Literature: Fan, Chong-Xu; Hao, Xiao-Lin; Ye, Yun-Hua Synthetic Communications, 1996 , vol. 26, # 7 p. 1455 - 1460 |
|
~%
methyl 2-[[4-am... CAS#:4976-86-7 |
| Literature: Yajima; Kiso; Kitagawa Chemical and Pharmaceutical Bulletin, 1974 , vol. 22, # 5 p. 1079 - 1086 |
| Z-Asp(NH2)-Phe-OMe |
| Benzyloxycarbonyl-asparaginyl-phenylalanin-methylester (L) |
| Cbz-L-Asn-L-Phe-OMe |
| methyl 2-(2-{[(benzyloxy)carbonyl]amino}butanediamido)-3-phenylpropanoate |
| methyl N2-[(benzyloxy)carbonyl]asparaginylphenylalaninate |
| methyl (2S)-2-[[(2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoate |
| Benzyloxycarbonyl-L-asparaginyl-L-phenylalaninmethylester |
| Z-AsnPheOMe |
| benzyloxycarbonylasparaginyl-phenylalanine methyl ester |