Dimethyl Benzylmalonate structure
|
Common Name | Dimethyl Benzylmalonate | ||
|---|---|---|---|---|
| CAS Number | 49769-78-0 | Molecular Weight | 222.23700 | |
| Density | 1.13 | Boiling Point | 285ºC | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.5ºC | |
| Name | dimethyl 2-benzylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13 |
|---|---|
| Boiling Point | 285ºC |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 139.5ºC |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 1.19130 |
| Index of Refraction | 1.503 |
| InChIKey | ZMYJSOIMFGAQRQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccccc1)C(=O)OC |
| HS Code | 2917399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| dimethylbenzylmalonate |
| 2-benzyl dimethylmalonate |
| 2-benzyl-malonic acid dimethyl ester |
| DiMethyl BenzylMalonate |
| Dimethyl 2-benzylmalonate |
| Benzylmalonic Acid Dimethyl Ester |