Dimethyl Benzylidenemalonate structure
|
Common Name | Dimethyl Benzylidenemalonate | ||
|---|---|---|---|---|
| CAS Number | 6626-84-2 | Molecular Weight | 220.22100 | |
| Density | 1.179g/cm3 | Boiling Point | 282.9ºC at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134ºC | |
| Name | dimethyl 2-benzylidenepropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 282.9ºC at 760 mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 134ºC |
| Exact Mass | 220.07400 |
| PSA | 52.60000 |
| LogP | 1.41600 |
| Index of Refraction | 1.549 |
| InChIKey | HPLVTKYRGZZXJF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=Cc1ccccc1)C(=O)OC |
| HS Code | 2917399090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-benzylidenemalonic acid dimethylester |
| Dimethyl benzylidenemalonate |
| dimethyl benzylidenepropanedioate |
| dimethyl 2-benzylidenemalonate |
| 1,1-biscarbomethoxy-2-phenylethylene |