(R)-2-Chloro-2-oxo-1-phenylethyl acetate structure
|
Common Name | (R)-2-Chloro-2-oxo-1-phenylethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 49845-69-4 | Molecular Weight | 212.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-acetylphenyl)-2-hydroxyacetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9ClO3 |
|---|---|
| Molecular Weight | 212.63000 |
| Exact Mass | 212.02400 |
| PSA | 54.37000 |
| LogP | 1.68800 |
| Index of Refraction | 1.564 |
| InChIKey | BERNQQVIUAZUHY-SECBINFHSA-N |
| SMILES | CC(=O)OC(C(=O)Cl)c1ccccc1 |
| Hazard Codes | T+ |
|---|---|
| Hazard Class | 6.1,8 |
|
~98%
(R)-2-Chloro-2-... CAS#:49845-69-4 |
| Literature: Corey, E. J.; Naef, Reto; Hannon, Francis J. Journal of the American Chemical Society, 1986 , vol. 108, # 22 p. 7114 - 7116 |
|
~%
(R)-2-Chloro-2-... CAS#:49845-69-4 |
| Literature: Bolm, Carsten; Zani, Lorenzo; Rudolph, Jens; Schiffers, Ingo Synthesis, 2004 , # 13 p. 2173 - 2180 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD22543909 |