5-[(4-Benzyloxy)benzyl]-2,4-diaminopyrimidine structure
|
Common Name | 5-[(4-Benzyloxy)benzyl]-2,4-diaminopyrimidine | ||
|---|---|---|---|---|
| CAS Number | 49873-11-2 | Molecular Weight | 306.36200 | |
| Density | 1.252g/cm3 | Boiling Point | 575.1ºC at 760 mmHg | |
| Molecular Formula | C18H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.6ºC | |
| Name | 5-[(4-Benzyloxy)benzyl]-2,4-diaminopyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 575.1ºC at 760 mmHg |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.36200 |
| Flash Point | 301.6ºC |
| Exact Mass | 306.14800 |
| PSA | 87.05000 |
| LogP | 3.97320 |
| Index of Refraction | 1.67 |
| InChIKey | NTVMHTFWSNGDLC-UHFFFAOYSA-N |
| SMILES | Nc1ncc(Cc2ccc(OCc3ccccc3)cc2)c(N)n1 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
|
Name: In vitro antimalarial activity against Plasmodium falciparum K1CB1 double DHFR mutati...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL769664
|
|
Name: In vitro antimalarial activity against Plasmodium falciparum TM4/8.2 wtDHFR
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL769665
|
|
Name: In vitro antimalarial activity against Plasmodium falciparum K1CB1 double DHFR mutant...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL769492
|
|
Name: In vitro antimalarial activity relative to trimethoprim against Plasmodium falciparum...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL769668
|
|
Name: Inhibitory activity against double mutant dihydrofolate reductase (C59R S108N DHFR), ...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL667617
|
|
Name: Activity against dihydrofolate reductase of Escherichia coli strain MB 1428
Source: ChEMBL
Target: Dihydrofolate reductase
External Id: CHEMBL667704
|
|
Name: Inhibitory activity against quadruple mutant dihydrofolate reductase (N51I C59R S108N...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL667618
|
|
Name: In vitro antimalarial activity relative to trimethoprim against Plasmodium falciparum...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL769666
|
|
Name: Inhibitory activity against triple mutant dihydrofolate reductase (C59R S108N I164L D...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL667619
|
|
Name: In vitro antimalarial activity against Plasmodium falciparum Vl/S with quadruple DHFR...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL769667
|
| 5-(4-benzoyl-piperazin-1-yl)-pentanoic acid ethyl ester |
| 5-(4-benzyloxy-benzyl)-pyrimidine-2,4-diamine |