WAY-303388 structure
|
Common Name | WAY-303388 | ||
|---|---|---|---|---|
| CAS Number | 499210-92-3 | Molecular Weight | 300.26948 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 509.6±52.0 °C at 760 mmHg | |
| Molecular Formula | C14H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.0±30.7 °C | |
Use of WAY-303388inhibiting a-synuclein toxicity and diseases |
| Name | WAY-303388 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 509.6±52.0 °C at 760 mmHg |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.26948 |
| Flash Point | 262.0±30.7 °C |
| Exact Mass | 300.085846 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | XEGSTCHAOIVDPY-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(Nc2nc3ccccc3o2)n1 |
| 4-Pyrimidineacetic acid, 2-(2-benzoxazolylamino)-3,6-dihydro-6-oxo-, methyl ester |
| Methyl [2-(1,3-benzoxazol-2-ylamino)-6-oxo-3,6-dihydro-4-pyrimidinyl]acetate |
| 4-pyrimidineacetic acid, 2-[(2Z)-2(3H)-benzoxazolylideneamino]-3,6-dihydro-6-oxo-, methyl ester |