5-(dimethylaminomethyl)-2-hydroxy-benzoic acid structure
|
Common Name | 5-(dimethylaminomethyl)-2-hydroxy-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4995-99-7 | Molecular Weight | 195.21500 | |
| Density | 1.243g/cm3 | Boiling Point | 326.9ºC at 760 mmHg | |
| Molecular Formula | C10H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.5ºC | |
| Name | 5-dimethylaminomethyl-2-hydroxy-benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 326.9ºC at 760 mmHg |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21500 |
| Flash Point | 151.5ºC |
| Exact Mass | 195.09000 |
| PSA | 60.77000 |
| LogP | 1.15200 |
| Index of Refraction | 1.589 |
| InChIKey | VGQCIGWUSSAYNC-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1ccc(O)c(C(=O)O)c1 |
|
~%
5-(dimethylamin... CAS#:4995-99-7 |
| Literature: Blicke; McCarty Journal of Organic Chemistry, 1959 , vol. 24, p. 1061,1064,1068 |
|
~%
5-(dimethylamin... CAS#:4995-99-7 |
| Literature: Blicke; McCarty Journal of Organic Chemistry, 1959 , vol. 24, p. 1061,1064,1068 |
|
~%
5-(dimethylamin... CAS#:4995-99-7 |
| Literature: Blicke; McCarty Journal of Organic Chemistry, 1959 , vol. 24, p. 1061,1064,1068 |
|
~%
5-(dimethylamin... CAS#:4995-99-7 |
| Literature: Bayer and Co. Patent: DE121051 ; |
| 5-Dimethylaminoisophthalonitrile |
| 5-Dimethylaminomethyl-2-hydroxy-benzoesaeure |
| 2-Hydroxy-5-dimethylaminomethyl-benzoesaeure |
| 5-Dimethylaminomethylsalicylsaeure |
| 31-Dimethylamino-6-oxy-m-toluylsaeure |
| 3,5-dicyano-N,N-dimethylaniline |