Ethanone,2,2-dihydroxy-1-(4-nitrophenyl)- structure
|
Common Name | Ethanone,2,2-dihydroxy-1-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 4996-22-9 | Molecular Weight | 197.14500 | |
| Density | 1.537g/cm3 | Boiling Point | 356.7ºC at 760mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | 96-98°C | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | 4-Nitrophenylglyoxal hydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.537g/cm3 |
|---|---|
| Boiling Point | 356.7ºC at 760mmHg |
| Melting Point | 96-98°C |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14500 |
| Flash Point | 160ºC |
| Exact Mass | 197.03200 |
| PSA | 89.19000 |
| LogP | 1.43530 |
| InChIKey | DUGSDYIJZMWGNA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)C(O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
|
~74%
Ethanone,2,2-di... CAS#:4996-22-9 |
| Literature: Tetrahedron Asymmetry, , vol. 21, # 18 p. 2244 - 2248 |
|
~%
Ethanone,2,2-di... CAS#:4996-22-9 |
| Literature: Tetrahedron Letters, , vol. 52, # 31 p. 4036 - 4038 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-nitrophenylglyoxal hydrate |