5,5-diethyl-1-methyl-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5,5-diethyl-1-methyl-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 50-11-3 | Molecular Weight | 198.21900 | |
| Density | 1.122g/cm3 | Boiling Point | 302ºC at 760mmHg | |
| Molecular Formula | C9H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.4ºC | |
| Name | 5,5-diethyl-1-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 302ºC at 760mmHg |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.21900 |
| Flash Point | 136.4ºC |
| Exact Mass | 198.10000 |
| PSA | 66.48000 |
| LogP | 0.76770 |
| Index of Refraction | 1.467 |
| InChIKey | FWJKNZONDWOGMI-UHFFFAOYSA-N |
| SMILES | CCC1(CC)C(=O)NC(=O)N(C)C1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| RIDADR | UN 3249 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2933540000 |
|
~65%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Jenny, Christjohannes; Hesse, Manfred Helvetica Chimica Acta, 1981 , vol. 64, # 6 p. 1807 - 1811 |
|
~14%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Aoyama, Hiromu; Hatori, Hiroaki Tetrahedron, 1990 , vol. 46, # 11 p. 3781 - 3788 |
|
~%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Conrad; Zart Justus Liebigs Annalen der Chemie, 1905 , vol. 340, p. 339 |
|
~%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Conrad; Zart Justus Liebigs Annalen der Chemie, 1905 , vol. 340, p. 339 |
|
~%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Conrad; Zart Justus Liebigs Annalen der Chemie, 1905 , vol. 340, p. 339 |
|
~%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Halpern; Jones Journal of the American Pharmaceutical Association (1912-1977), 1949 , vol. 38, p. 352 |
|
~%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Majima Chemische Berichte, 1908 , vol. 41, p. 185 |
|
~%
5,5-diethyl-1-m... CAS#:50-11-3 |
| Literature: Conrad; Zart Justus Liebigs Annalen der Chemie, 1905 , vol. 340, p. 339 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5,5-Diaethyl-1-methyl-2,4,6-trioxo-hexahydropyrimidin |
| Metabarbital |
| Gemonil |
| Endiemal |
| 5,5-diethyl-N-methyl-barbituric acid |
| metharbital |
| N-Methylbarbital |
| 5,5-Diethyl-1-methylbarbitursaeure |
| Methabarbital |
| Methylbarbital |
| 1-methyl-5,5-diethylbarbituric acid |
| Metharbitone |
| Metharbutal |
| Endiemalum |