DDT structure
|
Common Name | DDT | ||
|---|---|---|---|---|
| CAS Number | 50-29-3 | Molecular Weight | 354.486 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 416.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H9Cl5 | Melting Point | 107-110 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 203.9±24.7 °C | |
| Symbol |
GHS02, GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | ddt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.2±40.0 °C at 760 mmHg |
| Melting Point | 107-110 °C(lit.) |
| Molecular Formula | C14H9Cl5 |
| Molecular Weight | 354.486 |
| Flash Point | 203.9±24.7 °C |
| Exact Mass | 351.914703 |
| LogP | 5.92 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | YVGGHNCTFXOJCH-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, iron and aluminium and their salts, alkalies. |
| Symbol |
GHS02, GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370-H410 |
| Precautionary Statements | P210-P260-P273-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | O,T |
| Risk Phrases | 25-40-48/25-50/53-36/37/38-11-39/23/24/25-23/24/25-52/53 |
| Safety Phrases | 22-36/37-45-60-61-36-33-26-16-7 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | KJ3325000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2903920000 |
| HS Code | 2903920000 |
|---|---|
| Summary | 2903920000 perchlorobenzene。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:5.5%。general tariff:30.0% |
|
Exploring the impact of drug properties on the extent of intestinal lymphatic transport - in vitro and in vivo studies.
Pharm. Res. 32(5) , 1817-29, (2015) Intestinal lymphatic transport of specific lipophilic drugs offers therapeutic advantages and maximises oral bioavailability. The aims of this study were; to compare intestinal lymphatic transport of ... |
|
|
β-Hemolytic streptococcal throat carriage and tonsillopharyngitis: a cross-sectional prevalence study in Gabon, Central Africa.
Infection 43(2) , 177-83, (2015) Group A streptococcus (GAS) and possibly other β-hemolytic streptococci (BHS) account for a considerable morbidity and mortality burden in African populations; however, disproportionately little is kn... |
|
|
Risk assessment for children exposed to DDT residues in various milk types from the Greek market.
Food Chem. Toxicol. 75 , 156-65, (2015) The occurrence of residues of DDT and its metabolites was monitored in 196 cow milk samples of various pasteurized commercial types collected from the Greek market. Residue levels were determined by G... |
| 1,1,1-Trichlor-2,2-bis-(4-methoxy-3-nitro-phenyl)-aethan |
| Benzene,1,1'-(2,2,2-trichloroethylidene)bis[4-methoxy-3-nitro |
| 1,1’-(2,2,2-trichloroethane-1,1-diyl)bis(4-chlorobenzene) |
| 1,1,1-trichloro-2,2-bis(4-methoxy-3-nitrophenyl)ethane |
| Clofenotan |
| a,a-Bis(p-chlorophenyl)-b,b,b-trichlorethane |
| 1,1'-(2,2,2-trichloroethane-1,1-diyl)bis(4-chlorobenzene) |
| 1,1-bis(p-chlorophenyl)-2,2,2-trichloroethane |
| P,P'-DDT |
| DDT |
| Penticide |
| neocidol powder |
| 1,1,1-trichloro-2,2-bis(p-chlorophenyl)-ethane |
| MFCD00000802 |
| Trichloro-2,2-bis(p-chlorophenyl)ethane |
| 2,2-bis(p-chlorophenyl)-1,1,1-trichloroethane |
| 1,1'-(2,2,2-Trichloro-1,1-ethanediyl)bis(4-chlorobenzene) |
| clofenotane |
| 1,1’-(2,2,2-trichloroethylidene)bis[4-chlorobenzene] |
| dichlorodiphenyltrichloroethane |
| Klorfenoton |
| dicophane |
| 1,1,1-Trichloro-2,2-bis(p-chlorophenyl)ethane |
| 4,4′-DDT |
| 4,4'-DDT |
| Chlorphenotane |
| 1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane |
| EINECS 200-024-3 |
| p'-Zeidane |
| p',p'-DDT |
| 4,4'-Dichlorodiphenyltrichloroethane |
| 1,1,1-trichloro-2,2-bis[4-chlorophenyl]ethane |
| p,p'-dichlorodiphenyltrichloroethane |