DL-N-Boc-β-(3-Chlorophenyl)-alanine structure
|
Common Name | DL-N-Boc-β-(3-Chlorophenyl)-alanine | ||
|---|---|---|---|---|
| CAS Number | 500770-74-1 | Molecular Weight | 299.750 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 445.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3±27.3 °C | |
| Name | (3S)-3-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.6±40.0 °C at 760 mmHg |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.750 |
| Flash Point | 223.3±27.3 °C |
| Exact Mass | 299.092438 |
| PSA | 75.63000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | UDUKZORPLJUWTF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3S)-3-(3-Chlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| DL-N-Boc-β-(3-Chlorophenyl)-alanine |
| 3-[(tert-Butoxycarbonyl)amino]-3-(3-chlorophenyl)propanoic acid |
| Boc-3-Chloro-L-b-phenylalanine |
| 3-(3-Chlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Benzenepropanoic acid, 3-chloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βS)- |
| Benzenepropanoic acid, 3-chloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]- |