DL-N-Boc-β-(4-Chlorophenyl)-alanine structure
|
Common Name | DL-N-Boc-β-(4-Chlorophenyl)-alanine | ||
|---|---|---|---|---|
| CAS Number | 479064-93-2 | Molecular Weight | 299.750 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 453.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H18ClNO4 | Melting Point | 135-136°C | |
| MSDS | Chinese USA | Flash Point | 228.3±27.3 °C | |
| Name | (3R)-3-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 453.9±40.0 °C at 760 mmHg |
| Melting Point | 135-136°C |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.750 |
| Flash Point | 228.3±27.3 °C |
| Exact Mass | 299.092438 |
| PSA | 75.63000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | ZPXVKCUGZBGIBW-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1ccc(Cl)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenepropanoic acid, 4-chloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)- |
| 3-[(tert-Butoxycarbonyl)amino]-3-(4-chlorophenyl)propanoic acid |
| Benzenepropanoic acid, 4-chloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βS)- |
| (3S)-3-(4-Chlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Benzenepropanoic acid, 4-chloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| (R)-3-((tert-Butoxycarbonyl)amino)-3-(4-chlorophenyl)propanoic acid |
| 3-(4-Chlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Boc-4-Chloro-D-b-phenylalanine |
| (3R)-3-(4-Chlorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| DL-N-Boc-β-(4-Chlorophenyl)-alanine |
| MFCD03427960 |