Barium 2-cyanoethyl phosphate structure
|
Common Name | Barium 2-cyanoethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 5015-38-3 | Molecular Weight | 286.369 | |
| Density | N/A | Boiling Point | 404.6ºC at 760mmHg | |
| Molecular Formula | C3H4BaNO4P | Melting Point | >300°C | |
| MSDS | Chinese USA | Flash Point | 198.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | barium 2-cyanoethylphosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 404.6ºC at 760mmHg |
|---|---|
| Melting Point | >300°C |
| Molecular Formula | C3H4BaNO4P |
| Molecular Weight | 286.369 |
| Flash Point | 198.5ºC |
| Exact Mass | 286.893036 |
| PSA | 106.02000 |
| LogP | 0.88578 |
| InChIKey | MRQIDZJGQMWVQR-UHFFFAOYSA-L |
| SMILES | N#CCCOP(=O)([O-])[O-].[Ba+2] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H332 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R20/22 |
| Safety Phrases | S28 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 1 |
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
O6-alkyldeoxyguanosine detection by 32P-postlabeling and nucleotide chromatographic analysis.
Cancer Res. 48(8) , 2156-61, (1988) The 32P-postlabeling procedure, developed originally by Randerath and coworkers, has been modified for the detection and analytical quantitation of O6-alkyl-2'-deoxyguanosine residues in DNA. Chromato... |
| 2-Cyanoethylphosporic Acid Barium Salt Hydrate |
| 2-CYANOETHYLPHOSPORIC ACID BARIUM SALT |
| Barium 2-Cyanoethylphosphate Hydrate [Phosphorylating Agent] |
| 3-(phosphonooxy)-propanenitrilbariumsalt(1:1) |
| (2-cyanoethyl) phosphate barium salt |
| Propanenitrile,3-(phosphonooxy)-,barium salt (1:1) |
| Phosphoric acid 2-cyanoethyl ester barium salt |
| BARIUM 2-CYANOETHYL PHOSPHATE 2-HYDRATE |
| MFCD00012588 |
| barium cyanoethylphosphate |
| Barium 2-cyanoethyl phosphate |
| EINECS 225-696-5 |
| Propanenitrile, 3-(phosphonooxy)-, barium salt (1:1) |
| cyanoethyl phosphate barium salt |
| Phosphoric acid barium(2-cyanoethyl) ester salt |
| 2-cyanoethylphosphoric acid barium salt |
| 2-Cyanoethyl Phosphate,Barium Salt Dihydrate |
| (2-Cyanoethyl)oxyphosphonic acid barium salt |
| Barium 2-cyanoethyl phosphate,Phosphoric acid 2-cyanoethyl ester barium salt |