3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride structure
|
Common Name | 3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 502496-23-3 | Molecular Weight | 280.598 | |
| Density | N/A | Boiling Point | 237.7ºC at 760 mmHg | |
| Molecular Formula | C8H7ClF6N2 | Melting Point | 80-83ºC | |
| MSDS | N/A | Flash Point | 97.5ºC | |
| Name | 3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 237.7ºC at 760 mmHg |
|---|---|
| Melting Point | 80-83ºC |
| Molecular Formula | C8H7ClF6N2 |
| Molecular Weight | 280.598 |
| Flash Point | 97.5ºC |
| Exact Mass | 280.020203 |
| PSA | 38.05000 |
| LogP | 4.58510 |
| InChIKey | OPIOKSFIERNABH-UHFFFAOYSA-N |
| SMILES | Cl.NNc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| [3,5-Bis(trifluoromethyl)phenyl]hydrazine hydrochloride |
| [3,5-Bis(trifluoromethyl)phenyl]hydrazinium chloride |
| FXFFR CMZ EXFFF &&HCl |
| 3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride |
| [3,5-bis(trifluoromethyl)phenyl]hydrazine,hydrochloride |
| MFCD03094165 |
| [3,5-Bis(trifluoromethyl)phenyl]hydrazine hydrochloride (1:1) |
| Hydrazine, [3,5-bis(trifluoromethyl)phenyl]-, hydrochloride (1:1) |